CAS 1609396-69-1

Benzenamine, 2-(hexahydro-1H-azepin-1-yl)-5-methyl-, hydrochloride (1:2)

Description:

Benzenamine, 2-(hexahydro-1H-azepin-1-yl)-5-methyl-, hydrochloride (1:2) is a chemical compound characterized by its amine functional group and a hexahydroazepine moiety, which contributes to its cyclic structure and potential for various interactions. The presence of the benzene ring imparts aromatic characteristics, while the hexahydroazepine structure introduces a saturated nitrogen-containing ring, influencing its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the methyl group at the 5-position of the benzene ring, which can affect steric and electronic properties. Overall, this compound's unique structure suggests potential applications in drug development and synthesis, although specific biological activities and applications would require further investigation.

Formula: C₁₃H₂₀N₂·2ClH

InChI: InChI=1S/C13H20N2.2ClH/c1-11-6-7-13(12(14)10-11)15-8-4-2-3-5-9-15;;/h6-7,10H,2-5,8-9,14H2,1H3;2*1H

InChI key: InChIKey=FPHFPZZUKMAUBJ-UHFFFAOYSA-N

SMILES: NC1=C(N2CCCCCC2)C=CC(C)=C1.Cl

Synonyms:

• Benzenamine, 2-(hexahydro-1H-azepin-1-yl)-5-methyl-, hydrochloride (1:2)

[2-(1-azepanyl)-5-methylphenyl]amine dihydrochloride

CAS: 1609396-69-1

Formula: C₁₃H₂₂Cl₂N₂

Purity: 95.0%

Molecular weight: 277.23

Ref: 10-F359748