CAS 1609399-75-8

Carbonic acid, compd. with 1-cyclopentyl-4-[(methylamino)methyl]-2-pyrrolidinone (1:1)

Description:

Carbonic acid, compd. with 1-cyclopentyl-4-[(methylamino)methyl]-2-pyrrolidinone (1:1), identified by CAS number 1609399-75-8, is a chemical compound that features a unique combination of a carbonic acid moiety and a pyrrolidinone derivative. The compound exhibits characteristics typical of both components: the carbonic acid part contributes to its acidity and potential reactivity, while the pyrrolidinone structure may impart specific pharmacological properties, such as solubility and interaction with biological targets. The presence of the cyclopentyl group suggests a degree of steric hindrance, which can influence the compound's overall stability and reactivity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity and the ability to modulate various physiological processes. However, detailed studies on its specific properties, including solubility, stability, and biological effects, would be necessary to fully understand its applications and behavior in different environments.

Formula: C₁₁H₂₀N₂O·CH₂O₃

InChI: InChI=1S/C11H20N2O.CH2O3/c1-12-7-9-6-11(14)13(8-9)10-4-2-3-5-10;2-1(3)4/h9-10,12H,2-8H2,1H3;(H2,2,3,4)

InChI key: InChIKey=CMJWXBSCYITFKX-UHFFFAOYSA-N

SMILES: O=C1N(CC(CNC)C1)C2CCCC2.C(=O)(O)O

Synonyms:

• Carbonic acid, compd. with 1-cyclopentyl-4-[(methylamino)methyl]-2-pyrrolidinone (1:1)

1-cyclopentyl-4-[(methylamino)methyl]-2-pyrrolidinone - carbonic acid (1:1)

CAS: 1609399-75-8

Formula: C₁₂H₂₂N₂O₄

Purity: 95.0%

Molecular weight: 258.318

Ref: 10-F359088