CAS 1609399-78-1

Carbamic acid, N-[(1R,3R)-3-aminocyclohexyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1), rel-

Description:

Carbamic acid, N-[(1R,3R)-3-aminocyclohexyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a carbamic acid moiety linked to a cyclohexylamine derivative. This compound features a tertiary amine and an ester functional group, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a protonated version of the base, which can enhance its solubility in aqueous environments. The specific stereochemistry, denoted by the (1R,3R) configuration, suggests that the compound may exhibit unique interactions in biological systems, potentially influencing its pharmacological properties. Typically, such compounds are investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The presence of the dimethyl group may also affect the steric and electronic properties of the molecule, influencing its reactivity and interaction with biological targets. Overall, this compound represents a class of substances with potential therapeutic applications, warranting further study to elucidate its properties and effects.

Formula: C₁₁H₂₂N₂O₂·ClH

InChI: InChI=1/C11H22N2O2.ClH/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9;/h8-9H,4-7,12H2,1-3H3,(H,13,14);1H/t8-,9-;/s2

InChI key: InChIKey=LLEANKHCIRWNRG-IFTUBXIWNA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1C[C@H](N)CCC1.Cl

Synonyms:

• Carbamic acid, N-[(1R,3R)-3-aminocyclohexyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1), rel-

tert-butyl [(1R,3R)-3-aminocyclohexyl]carbamate hydrochloride

CAS: 1609399-78-1

Formula: C₁₁H₂₃ClN₂O₂

Purity: 95%

Molecular weight: 250.77

Ref: 10-F360396