CAS 1609399-92-9

4-Piperidinamine, 1-oxazolo[4,5-b]pyridin-2-yl-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-oxazolo[4,5-b]pyridin-2-yl-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a piperidine ring and an oxazolo[4,5-b]pyridine moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is beneficial for various applications in medicinal chemistry. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The oxazolo[4,5-b]pyridine structure may contribute to its reactivity and interaction with biological targets. As with many compounds in this class, it is essential to consider its stability, solubility, and potential toxicity when evaluating its suitability for research or therapeutic use. Additionally, the compound's CAS number, 1609399-92-9, serves as a unique identifier for regulatory and safety information, facilitating its handling in laboratory and industrial settings. Overall, this compound represents a fascinating area of study within the realm of heterocyclic chemistry and drug development.

Formula: C₁₁H₁₄N₄O·2ClH

InChI: InChI=1S/C11H14N4O.2ClH/c12-8-3-6-15(7-4-8)11-14-10-9(16-11)2-1-5-13-10;;/h1-2,5,8H,3-4,6-7,12H2;2*1H

InChI key: InChIKey=OXFYWMAVQDMMOB-UHFFFAOYSA-N

SMILES: NC1CCN(C2=NC=3C(O2)=CC=CN3)CC1.Cl

Synonyms:

• 4-Piperidinamine, 1-oxazolo[4,5-b]pyridin-2-yl-, hydrochloride (1:2)

1-[1,3]oxazolo[4,5-b]pyridin-2-yl-4-piperidinamine dihydrochloride

CAS: 1609399-92-9

Formula: C₁₁H₁₆Cl₂N₄O

Purity: 95.0%

Molecular weight: 291.18

Ref: 10-F358579