CAS 1609399-96-3

4-Piperidinamine, 1-[5-(1,1-dimethylethyl)-2-benzoxazolyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[5-(1,1-dimethylethyl)-2-benzoxazolyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and benzoxazole moieties, which contribute to its biological activity and potential pharmacological properties. The presence of the piperidine ring suggests that it may exhibit basic properties, allowing it to form salts, such as the hydrochloride form, which enhances its solubility in aqueous environments. The benzoxazole component is known for its role in various medicinal applications, often associated with anti-inflammatory and antimicrobial activities. The compound's structure indicates that it may interact with biological targets, making it of interest in drug development. Additionally, the presence of the tert-butyl group (1,1-dimethylethyl) can influence the compound's lipophilicity and overall pharmacokinetic profile. As with many synthetic compounds, safety and handling precautions are essential, and its effects on human health and the environment should be thoroughly evaluated through appropriate studies.

Formula: C₁₆H₂₃N₃O·2ClH

InChI: InChI=1S/C16H23N3O.2ClH/c1-16(2,3)11-4-5-14-13(10-11)18-15(20-14)19-8-6-12(17)7-9-19;;/h4-5,10,12H,6-9,17H2,1-3H3;2*1H

InChI key: InChIKey=DRKHMDPUYRQOCU-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1C=C2C(OC(=N2)N3CCC(N)CC3)=CC1.Cl

Synonyms:

• 4-Piperidinamine, 1-[5-(1,1-dimethylethyl)-2-benzoxazolyl]-, hydrochloride (1:2)

1-(5-tert-butyl-1,3-benzoxazol-2-yl)-4-piperidinamine dihydrochloride

CAS: 1609399-96-3

Formula: C₁₆H₂₅Cl₂N₃O

Purity: 95.0%

Molecular weight: 346.3

Ref: 10-F358583