CAS 1609400-03-4

Imidazo[1,2-a]pyridine, 5-bromo-2-methyl-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine, 5-bromo-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused imidazole and pyridine ring system. The presence of a bromine atom at the 5-position and a methyl group at the 2-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including medicinal chemistry. This compound may exhibit pharmacological properties, making it of interest in drug development, particularly in the context of targeting specific biological pathways. Its molecular structure allows for potential interactions with various biological targets, which can be explored in research settings. Safety and handling precautions should be observed, as with any chemical substance, particularly those that may have biological activity. Overall, this compound represents a valuable entity in the field of organic and medicinal chemistry.

Formula: C₈H₇BrN₂·ClH

InChI: InChI=1S/C8H7BrN2.ClH/c1-6-5-11-7(9)3-2-4-8(11)10-6;/h2-5H,1H3;1H

InChI key: InChIKey=CBEXFBLYOLENOU-UHFFFAOYSA-N

SMILES: BrC=1N2C(=NC(C)=C2)C=CC1.Cl

Synonyms:

• Imidazo[1,2-a]pyridine, 5-bromo-2-methyl-, hydrochloride (1:1)

5-bromo-2-methylimidazo[1,2-a]pyridine hydrochloride

CAS: 1609400-03-4

Formula: C₈H₈BrClN₂

Purity: 95.0%

Molecular weight: 247.52

Ref: 10-F360491