CAS 1609400-33-0

2-Pyrazinemethanamine, 6-chloro-N,N-dimethyl-, hydrochloride (1:2)

Description:

2-Pyrazinemethanamine, 6-chloro-N,N-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazine ring structure, which contributes to its aromatic properties. The presence of a chloro substituent at the 6-position enhances its reactivity and potential biological activity. The dimethylamino group indicates that it may exhibit basic properties, allowing it to form a hydrochloride salt, which typically increases solubility in water and stability. This compound is likely to be of interest in pharmaceutical research due to its potential applications in drug development, particularly in the context of targeting specific biological pathways. Its molecular interactions may involve hydrogen bonding and other non-covalent interactions, which are crucial for its biological efficacy. As with many chemical substances, safety and handling precautions are essential, as it may pose risks such as irritation or toxicity. Overall, 2-Pyrazinemethanamine, 6-chloro-N,N-dimethyl-, hydrochloride (1:2) represents a class of compounds that could be valuable in medicinal chemistry and related fields.

Formula: C₇H₁₀ClN₃·2ClH

InChI: InChI=1S/C7H10ClN3.2ClH/c1-11(2)5-6-3-9-4-7(8)10-6;;/h3-4H,5H2,1-2H3;2*1H

InChI key: InChIKey=VLYSYJUKSKQALR-UHFFFAOYSA-N

SMILES: C(N(C)C)C1=NC(Cl)=CN=C1.Cl

Synonyms:

• 2-Pyrazinemethanamine, 6-chloro-N,N-dimethyl-, hydrochloride (1:2)

[(6-chloro-2-pyrazinyl)methyl]dimethylamine dihydrochloride

CAS: 1609400-33-0

Formula: C₇H₁₂Cl₃N₃

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 244.54

Ref: 10-F359738