CAS 1609400-48-7

1H-Imidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, hydrochloride (1:2)

Description:

1H-Imidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its imidazole and phenoxy functional groups, which contribute to its potential biological activity. The imidazole ring is a five-membered heterocyclic structure containing two nitrogen atoms, known for its role in various biochemical processes, including enzyme catalysis and as a building block in pharmaceuticals. The presence of the hydroxyl group (ethanol) enhances its solubility in polar solvents, while the amino group on the phenoxy moiety may facilitate interactions with biological targets, potentially influencing its pharmacological properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in medicinal chemistry. The compound's specific interactions, efficacy, and safety profile would depend on its structural characteristics and the context of its use, particularly in drug development or research settings. Further studies would be necessary to elucidate its full range of properties and potential applications.

Formula: C₁₂H₁₅N₃O₂·2ClH

InChI: InChI=1S/C12H15N3O2.2ClH/c13-10-1-3-12(4-2-10)17-8-11(16)7-15-6-5-14-9-15;;/h1-6,9,11,16H,7-8,13H2;2*1H

InChI key: InChIKey=HQUPTNCJDBVTDV-UHFFFAOYSA-N

SMILES: C(C(COC1=CC=C(N)C=C1)O)N2C=CN=C2.Cl

Synonyms:

• 1H-Imidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-, hydrochloride (1:2)

1-(4-aminophenoxy)-3-(1H-imidazol-1-yl)-2-propanol dihydrochloride

CAS: 1609400-48-7

Formula: C₁₂H₁₇Cl₂N₃O₂

Purity: 95.0%

Molecular weight: 306.19

Ref: 10-F361581