CAS 1609400-55-6

Benzaldehyde, 2-[3-(1H-imidazol-1-yl)propoxy]-, hydrochloride (1:1)

Description:

Benzaldehyde, 2-[3-(1H-imidazol-1-yl)propoxy]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzaldehyde moiety and an imidazole ring connected by a propoxy chain. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit properties such as antimicrobial or antifungal activity, which are common in imidazole derivatives. Its hydrochloride form enhances stability and solubility, facilitating its use in various applications, including drug formulation and research. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, this compound represents a blend of aromatic and heterocyclic chemistry, making it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₃H₁₄N₂O₂·ClH

InChI: InChI=1S/C13H14N2O2.ClH/c16-10-12-4-1-2-5-13(12)17-9-3-7-15-8-6-14-11-15;/h1-2,4-6,8,10-11H,3,7,9H2;1H

InChI key: InChIKey=QSHXPCOMPJVEOL-UHFFFAOYSA-N

SMILES: O(CCCN1C=CN=C1)C2=C(C=O)C=CC=C2.Cl

Synonyms:

• Benzaldehyde, 2-[3-(1H-imidazol-1-yl)propoxy]-, hydrochloride (1:1)

2-[3-(1H-imidazol-1-yl)propoxy]benzaldehyde hydrochloride

CAS: 1609400-55-6

Formula: C₁₃H₁₅ClN₂O₂

Purity: 95.0%

Molecular weight: 266.73

Ref: 10-F361659