CAS 1609400-72-7

1,2,4-Oxadiazole-5-methanamine, 3-(3,4-dimethoxyphenyl)-α-methyl-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-methanamine, 3-(3,4-dimethoxyphenyl)-α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which contributes to its potential biological activity. The presence of the methanamine group suggests it may exhibit amine-like properties, influencing its solubility and reactivity. The 3-(3,4-dimethoxyphenyl) substituent indicates that the compound has aromatic characteristics, which can enhance its stability and interaction with biological targets. The α-methyl group may affect the steric hindrance and overall conformation of the molecule, potentially impacting its pharmacological properties. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound's specific interactions, biological activity, and potential therapeutic applications would require further investigation through experimental studies. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in medicinal chemistry.

Formula: C₁₂H₁₅N₃O₃·ClH

InChI: InChI=1S/C12H15N3O3.ClH/c1-7(13)12-14-11(15-18-12)8-4-5-9(16-2)10(6-8)17-3;/h4-7H,13H2,1-3H3;1H

InChI key: InChIKey=QDGBYAQYEPJUKU-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1OC)C=2N=C(C(C)N)ON2.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-methanamine, 3-(3,4-dimethoxyphenyl)-α-methyl-, hydrochloride (1:1)

{1-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}amine hydrochloride

CAS: 1609400-72-7

Formula: C₁₂H₁₆ClN₃O₃

Purity: 95.0%

Molecular weight: 285.73

Ref: 10-F361607