CAS 1609400-78-3

Isoquinoline, 1,2,3,4-tetrahydro-1,3,3-trimethyl-, hydrochloride (1:1)

Description:

Isoquinoline, 1,2,3,4-tetrahydro-1,3,3-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its tetrahydroisoquinoline structure, which features a bicyclic framework derived from isoquinoline. This compound is typically a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The presence of three methyl groups contributes to its lipophilicity and may influence its biological activity. As a hydrochloride salt, it exhibits enhanced stability and solubility compared to its free base form. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including effects on the central nervous system. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in various research applications, particularly in the development of pharmaceuticals. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₂H₁₇N·ClH

InChI: InChI=1S/C12H17N.ClH/c1-9-11-7-5-4-6-10(11)8-12(2,3)13-9;/h4-7,9,13H,8H2,1-3H3;1H

InChI key: InChIKey=RRZWGTBRGQQDJQ-UHFFFAOYSA-N

SMILES: CC1C=2C(CC(C)(C)N1)=CC=CC2.Cl

Synonyms:

• Isoquinoline, 1,2,3,4-tetrahydro-1,3,3-trimethyl-, hydrochloride (1:1)