CAS 1609400-81-8

Benzenamine, 3-chloro-2-(1-pyrrolidinyl)-, hydrochloride (1:2)

Description:

Benzenamine, 3-chloro-2-(1-pyrrolidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a benzene ring substituted with a chlorine atom and a pyrrolidine moiety. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more suitable for various applications, particularly in pharmaceutical contexts. The presence of the pyrrolidine group suggests potential biological activity, as pyrrolidine derivatives are often explored for their pharmacological properties. The compound's molecular interactions may involve hydrogen bonding and hydrophobic interactions due to its aromatic and aliphatic components. As with many chlorinated amines, it may exhibit specific reactivity patterns, including nucleophilic substitution. Safety data should be consulted, as chlorinated compounds can pose health risks, including toxicity and environmental concerns. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry and related fields.

Formula: C₁₀H₁₃ClN₂·2ClH

InChI: InChI=1S/C10H13ClN2.2ClH/c11-8-4-3-5-9(12)10(8)13-6-1-2-7-13;;/h3-5H,1-2,6-7,12H2;2*1H

InChI key: InChIKey=GTNHZYVMUBMLTR-UHFFFAOYSA-N

SMILES: ClC1=C(C(N)=CC=C1)N2CCCC2.Cl

Synonyms:

• Benzenamine, 3-chloro-2-(1-pyrrolidinyl)-, hydrochloride (1:2)

[3-chloro-2-(1-pyrrolidinyl)phenyl]amine dihydrochloride

CAS: 1609400-81-8

Formula: C₁₀H₁₅Cl₃N₂

Purity: 95.0%

Molecular weight: 269.59

Ref: 10-F359220