CAS 1609400-84-1

Cyclopropanemethanamine, N,2,2-trimethyl-, hydrochloride (1:1)

Description:

Cyclopropanemethanamine, N,2,2-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a trimethylamino group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it more stable for various applications. The presence of the cyclopropane moiety contributes to its potential reactivity and steric properties, while the trimethylamino group can influence its basicity and interaction with biological systems. As a hydrochloride, it is often used in pharmaceutical formulations, where it may serve as an intermediate or active ingredient. The compound's specific properties, such as melting point, boiling point, and solubility, can vary based on the conditions and purity. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, this compound's unique structural features make it of interest in both synthetic chemistry and potential medicinal applications.

Formula: C₇H₁₅N·ClH

InChI: InChI=1S/C7H15N.ClH/c1-7(2)4-6(7)5-8-3;/h6,8H,4-5H2,1-3H3;1H

InChI key: InChIKey=GNGPLAWTEXKNHN-UHFFFAOYSA-N

SMILES: C(NC)C1C(C)(C)C1.Cl

Synonyms:

• Cyclopropanemethanamine, N,2,2-trimethyl-, hydrochloride (1:1)

[(2,2-Dimethylcyclopropyl)methyl](methyl)amine hydrochloride

CAS: 1609400-84-1

Versatile small molecule scaffold

Formula: C₇H₁₆ClN

Purity: Min. 95%

Molecular weight: 149.66 g/mol

Ref: 3D-JPC40084