CAS 1609400-85-2

1H-Pyrazolo[4,3-c]pyridine-3-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, hydrochloride (1:1)

Description:

1H-Pyrazolo[4,3-c]pyridine-3-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound typically exhibits properties associated with both heterocyclic chemistry and carboxylic acid derivatives. As a hydrochloride salt, it is likely to be soluble in water and exhibit acidic properties due to the presence of the carboxylic acid functional group. The methyl ester group suggests that it may undergo hydrolysis to release the corresponding carboxylic acid upon exposure to aqueous conditions. The tetrahydro configuration indicates that the compound has a saturated ring system, which may influence its reactivity and biological activity. Such compounds are often of interest in medicinal chemistry for their potential pharmacological properties, including anti-inflammatory or antimicrobial activities. Overall, the specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise details.

Formula: C₈H₁₁N₃O₂·ClH

InChI: InChI=1S/C8H11N3O2.ClH/c1-13-8(12)7-5-4-9-3-2-6(5)10-11-7;/h9H,2-4H2,1H3,(H,10,11);1H

InChI key: InChIKey=JGSOHUPJNRNHNY-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(NN1)CCNC2.Cl

Synonyms:

• 1H-Pyrazolo[4,3-c]pyridine-3-carboxylic acid, 4,5,6,7-tetrahydro-, methyl ester, hydrochloride (1:1)

Methyl 1H,4H,5H,6H,7H-pyrazolo[4,3-c]pyridine-3-carboxylate hydrochloride

CAS: 1609400-85-2

Versatile small molecule scaffold

Formula: C₈H₁₂ClN₃O₂

Purity: Min. 95%

Molecular weight: 217.65 g/mol

Ref: 3D-JPC40085