CAS 1609400-87-4

1,4-Oxazepine-6-methanamine, hexahydro-4-methyl-, hydrochloride (1:2)

Description:

1,4-Oxazepine-6-methanamine, hexahydro-4-methyl-, hydrochloride (1:2) is a chemical compound characterized by its oxazepine ring structure, which consists of a seven-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The hexahydro-4-methyl designation indicates the presence of a saturated ring with a methyl group, contributing to its unique chemical properties. As a hydrochloride salt, it exhibits basic characteristics, making it suitable for various applications in pharmaceuticals and organic synthesis. The compound may also possess biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, this compound represents a class of heterocycles that are of interest in medicinal chemistry and materials science.

Formula: C₇H₁₆N₂O·2ClH

InChI: InChI=1S/C7H16N2O.2ClH/c1-9-2-3-10-6-7(4-8)5-9;;/h7H,2-6,8H2,1H3;2*1H

InChI key: InChIKey=WLTDWWJBNVRSJP-UHFFFAOYSA-N

SMILES: C(N)C1CN(C)CCOC1.Cl

Synonyms:

• 1,4-Oxazepine-6-methanamine, hexahydro-4-methyl-, hydrochloride (1:2)

[(4-methyl-1,4-oxazepan-6-yl)methyl]amine dihydrochloride

CAS: 1609400-87-4

Formula: C₇H₁₈Cl₂N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 217.13

Ref: 10-F360387