CAS 1609400-91-0

[1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid, 5,7-dimethyl-, hydrochloride (1:1)

Description:

[1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid, 5,7-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole and pyrimidine ring structures, which contribute to its potential biological activity. The presence of carboxylic acid functionality indicates it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in aqueous environments. The dimethyl substitutions at the 5 and 7 positions of the pyrimidine ring can influence the compound's steric and electronic properties, potentially affecting its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and efficacy would depend on further studies, including in vitro and in vivo evaluations.

Formula: C₈H₈N₄O₂·ClH

InChI: InChI=1S/C8H8N4O2.ClH/c1-4-3-5(2)12-8(9-4)10-6(11-12)7(13)14;/h3H,1-2H3,(H,13,14);1H

InChI key: InChIKey=UJLMZWGPSTUXJI-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC(C(O)=O)=N2)N=C(C)C1.Cl

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidine-2-carboxylic acid, 5,7-dimethyl-, hydrochloride (1:1)

5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid hydrochloride

CAS: 1609400-91-0

Formula: C₈H₉ClN₄O₂

Purity: 95.0%

Molecular weight: 228.64

Ref: 10-F360291