CAS 1609401-03-7

1,2,4-Oxadiazole-3-methanamine, 5-cyclobutyl-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-3-methanamine, 5-cyclobutyl-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring structure, which contributes to its potential biological activity. The presence of the methanamine group indicates that it may exhibit amine-like reactivity, potentially participating in hydrogen bonding and nucleophilic reactions. The cyclobutyl substituent introduces a cyclic aliphatic structure that can influence the compound's steric properties and overall conformation. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets. However, specific data regarding its toxicity, stability, and detailed pharmacological properties would require further investigation through experimental studies. Overall, the unique combination of functional groups and ring structures in this compound suggests potential utility in various chemical and biological applications.

Formula: C₇H₁₁N₃O·ClH

InChI: InChI=1S/C7H11N3O.ClH/c8-4-6-9-7(11-10-6)5-2-1-3-5;/h5H,1-4,8H2;1H

InChI key: InChIKey=PTVQCWFONUOVPN-UHFFFAOYSA-N

SMILES: C(N)C=1N=C(ON1)C2CCC2.Cl

Synonyms:

• 1,2,4-Oxadiazole-3-methanamine, 5-cyclobutyl-, hydrochloride (1:1)

[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl]amine hydrochloride

CAS: 1609401-03-7

Formula: C₇H₁₂ClN₃O

Purity: 95.0%

Molecular weight: 189.64

Ref: 10-F359487