CAS 1609401-07-1

Ethanamine, N-methyl-2-[4-(1-methylethyl)phenoxy]-, hydrochloride (1:1)

Description:

Ethanamine, N-methyl-2-[4-(1-methylethyl)phenoxy]-, hydrochloride (1:1), with the CAS number 1609401-07-1, is a chemical compound characterized by its amine functional group and a phenoxy moiety. This substance features a methyl group attached to the nitrogen atom of the ethanamine backbone, enhancing its solubility and reactivity. The presence of the 4-(1-methylethyl)phenoxy group contributes to its hydrophobic characteristics, which may influence its biological activity and interaction with other molecules. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand or a building block in organic synthesis. Its specific biological activity, toxicity, and environmental impact would depend on further studies and context of use. Overall, this compound represents a class of amines that can be utilized in medicinal chemistry and related fields.

Formula: C₁₂H₁₉NO·ClH

InChI: InChI=1S/C12H19NO.ClH/c1-10(2)11-4-6-12(7-5-11)14-9-8-13-3;/h4-7,10,13H,8-9H2,1-3H3;1H

InChI key: InChIKey=YSIPRJSCQOIVQR-UHFFFAOYSA-N

SMILES: O(CCNC)C1=CC=C(C(C)C)C=C1.Cl

Synonyms:

• Ethanamine, N-methyl-2-[4-(1-methylethyl)phenoxy]-, hydrochloride (1:1)

2-(4-Isopropylphenoxy)-N-methylethanamine hydrochloride

CAS: 1609401-07-1

2-(4-Isopropylphenoxy)-N-methylethanamine hydrochloride

Purity: 97%

Molecular weight: 229.75g/mol

Ref: 54-OR1055282

[2-(4-isopropylphenoxy)ethyl]methylamine hydrochloride

CAS: 1609401-07-1

Formula: C₁₂H₂₀ClNO

Purity: 95.0%

Molecular weight: 229.75

Ref: 10-F361674