CAS 1609401-10-6

3-Thiophenamine, tetrahydro-4-methoxy-, 1,1-dioxide, hydrochloride (1:1), (3R,4R)-rel-

Description:

3-Thiophenamine, tetrahydro-4-methoxy-, 1,1-dioxide, hydrochloride (1:1), (3R,4R)-rel- is a chemical compound characterized by its unique structural features, which include a thiophene ring and a tetrahydro structure. The presence of a methoxy group contributes to its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. The compound's stereochemistry, indicated by the (3R,4R)- designation, suggests specific spatial arrangements of its atoms, which can influence its biological activity and interaction with other molecules. This compound may exhibit properties relevant to medicinal chemistry, potentially serving as a precursor or active ingredient in pharmaceutical applications. Its molecular weight, melting point, and other physical properties would be essential for practical applications, but these specifics are not provided here. Overall, the compound's characteristics make it a subject of interest in various chemical and biological research fields.

Formula: C₅H₁₁NO₃S·ClH

InChI: InChI=1/C5H11NO3S.ClH/c1-9-5-3-10(7,8)2-4(5)6;/h4-5H,2-3,6H2,1H3;1H/t4-,5-;/s2

InChI key: InChIKey=ZAKKOQKZGDVKGA-LOHCEJOHNA-N

SMILES: O(C)[C@H]1[C@H](N)CS(=O)(=O)C1.Cl

Synonyms:

• 3-Thiophenamine, tetrahydro-4-methoxy-, 1,1-dioxide, hydrochloride (1:1), (3R,4R)-rel-

[(3S,4S)-4-methoxy-1,1-dioxidotetrahydro-3-thienyl]amine hydrochloride

CAS: 1609401-10-6

Formula: C₅H₁₂ClNO₃S

Purity: 95.0%

Molecular weight: 201.67

Ref: 10-F360790