CAS 1609401-17-3

Cycloheptanamine, N-[(3,4,5-trimethoxyphenyl)methyl]-, hydrobromide (1:1)

Description:

Cycloheptanamine, N-[(3,4,5-trimethoxyphenyl)methyl]-, hydrobromide (1:1) is a chemical compound characterized by its unique structure, which includes a cycloheptane ring and a trimethoxyphenyl group. The presence of the hydrobromide indicates that it is a salt form, which typically enhances its solubility in water and may influence its pharmacological properties. The trimethoxyphenyl moiety suggests potential interactions with biological systems, possibly affecting neurotransmitter pathways or other cellular mechanisms. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can impact its reactivity and interactions with other molecules. Its specific applications or biological activities would depend on further research, but compounds with similar structures are often investigated for their potential therapeutic effects. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of the hydrobromide salt, which can be corrosive.

Formula: C₁₇H₂₇NO₃·BrH

InChI: InChI=1S/C17H27NO3.BrH/c1-19-15-10-13(11-16(20-2)17(15)21-3)12-18-14-8-6-4-5-7-9-14;/h10-11,14,18H,4-9,12H2,1-3H3;1H

InChI key: InChIKey=QTWRTOLCGDNQSK-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C(OC)=CC(CNC2CCCCCC2)=C1.Br

Synonyms:

• Cycloheptanamine, N-[(3,4,5-trimethoxyphenyl)methyl]-, hydrobromide (1:1)