CAS 1609401-18-4

1-Oxa-9-azaspiro[5.5]undecan-4-amine, 9-methyl-, hydrochloride (1:2)

Description:

1-Oxa-9-azaspiro[5.5]undecan-4-amine, 9-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which includes both nitrogen and oxygen heteroatoms. The presence of a spiro system indicates that the molecule contains two rings that share a single atom, contributing to its rigidity and potential biological activity. The compound features a secondary amine, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The hydrochloride form suggests that the compound is a salt, which typically improves stability and solubility in aqueous environments. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and mechanisms of action would depend on its structural features and the functional groups present. As with many compounds containing nitrogen and oxygen, it may also be subject to various chemical reactions, including alkylation and acylation, which could further modify its properties and applications.

Formula: C₁₀H₂₀N₂O·2ClH

InChI: InChI=1S/C10H20N2O.2ClH/c1-12-5-3-10(4-6-12)8-9(11)2-7-13-10;;/h9H,2-8,11H2,1H3;2*1H

InChI key: InChIKey=YICCWXYQXOFOED-UHFFFAOYSA-N

SMILES: NC1CC2(CCN(C)CC2)OCC1.Cl

Synonyms:

• 1-Oxa-9-azaspiro[5.5]undecan-4-amine, 9-methyl-, hydrochloride (1:2)

9-methyl-1-oxa-9-azaspiro[5.5]undecan-4-amine dihydrochloride

CAS: 1609401-18-4

Formula: C₁₀H₂₂Cl₂N₂O

Purity: 95.0%

Molecular weight: 257.2

Ref: 10-F360795