CAS 1609401-19-5

1H-Pyrazole-1-ethanamine, β,4-dimethyl-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-ethanamine, β,4-dimethyl-, hydrochloride (1:1), with CAS number 1609401-19-5, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features an ethanamine side chain, contributing to its amine properties. The presence of the β,4-dimethyl substituents indicates that there are two methyl groups attached to the pyrazole ring, enhancing its lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit interesting pharmacological properties, making it a subject of research in medicinal chemistry. Its stability, solubility, and reactivity can be influenced by the hydrochloride form, which often affects its interaction with biological systems. Overall, this compound is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₇H₁₃N₃·ClH

InChI: InChI=1S/C7H13N3.ClH/c1-6-4-9-10(5-6)7(2)3-8;/h4-5,7H,3,8H2,1-2H3;1H

InChI key: InChIKey=DGVKXYGIPGKERD-UHFFFAOYSA-N

SMILES: C(CN)(C)N1C=C(C)C=N1.Cl

Synonyms:

• 1H-Pyrazole-1-ethanamine, β,4-dimethyl-, hydrochloride (1:1)

[2-(4-methyl-1H-pyrazol-1-yl)propyl]amine hydrochloride

CAS: 1609401-19-5

Formula: C₇H₁₄ClN₃

Purity: 95.0%

Molecular weight: 175.66

Ref: 10-F359735