CAS 1609401-22-0

Piperidine, 2-[2-(1-methyl-1H-imidazol-2-yl)ethyl]-, hydrochloride (1:2)

Description:

Piperidine, 2-[2-(1-methyl-1H-imidazol-2-yl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a side chain that includes a 1-methyl-1H-imidazole moiety, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the imidazole group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. The compound's structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the piperidine and imidazole functionalities can participate in hydrogen bonding and other interactions, which may be relevant for its activity as a ligand or in drug design. Overall, this compound's characteristics make it a subject of interest for research in medicinal chemistry and related fields.

Formula: C₁₁H₁₉N₃·2ClH

InChI: InChI=1S/C11H19N3.2ClH/c1-14-9-8-13-11(14)6-5-10-4-2-3-7-12-10;;/h8-10,12H,2-7H2,1H3;2*1H

InChI key: InChIKey=UTQNRRRZNYSMFZ-UHFFFAOYSA-N

SMILES: C(CC1CCCCN1)C=2N(C)C=CN2.Cl

Synonyms:

• Piperidine, 2-[2-(1-methyl-1H-imidazol-2-yl)ethyl]-, hydrochloride (1:2)

2-[2-(1-methyl-1H-imidazol-2-yl)ethyl]piperidine dihydrochloride

CAS: 1609401-22-0

Formula: C₁₁H₂₁Cl₂N₃

Purity: 95.0%

Molecular weight: 266.21

Ref: 10-F359006