CymitQuimica logo

CAS 1609401-36-6

:

2-Thiophenemethanamine, α-cyclohexyl-, hydrochloride (1:1)

Description:
2-Thiophenemethanamine, α-cyclohexyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a thiophene ring and a cyclohexyl group attached to a methanamine backbone. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the thiophene moiety contributes to its potential biological activity, as thiophenes are known for their diverse pharmacological properties. The cyclohexyl group may influence the compound's lipophilicity and steric properties, affecting its interaction with biological targets. As a hydrochloride salt, it is likely to exhibit stability under standard conditions, making it suitable for research and potential therapeutic applications. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, this compound's structural features suggest potential utility in medicinal chemistry and related fields.
Formula:C11H17NS·ClH
InChI:InChI=1S/C11H17NS.ClH/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9;/h4,7-9,11H,1-3,5-6,12H2;1H
InChI key:InChIKey=BIEZASSQRXCQGS-UHFFFAOYSA-N
SMILES:C(N)(C1=CC=CS1)C2CCCCC2.Cl
Synonyms:
  • 2-Thiophenemethanamine, α-cyclohexyl-, hydrochloride (1:1)
  • C-Cyclohexyl-C-thien-2-ylmethylamine hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.