CAS 1609402-66-5

1-Piperidineethanamine, β-(4-chlorophenyl)-, hydrochloride (1:1)

Description:

1-Piperidineethanamine, β-(4-chlorophenyl)-, hydrochloride (1:1), also known by its CAS number 1609402-66-5, is a chemical compound characterized by its piperidine and phenylamine structure. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and a β-(4-chlorophenyl) group, indicating the presence of a chlorinated phenyl moiety attached to the ethylamine chain. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceutical research. The presence of the 4-chloro substituent on the phenyl ring may influence its biological activity and interaction with specific receptors or enzymes. This compound is of interest in medicinal chemistry, particularly for its potential therapeutic effects, although specific biological activities and safety profiles would require further investigation through empirical studies. Proper handling and storage conditions should be observed due to its chemical nature and potential reactivity.

Formula: C₁₃H₁₉ClN₂·ClH

InChI: InChI=1S/C13H19ClN2.ClH/c14-12-6-4-11(5-7-12)13(10-15)16-8-2-1-3-9-16;/h4-7,13H,1-3,8-10,15H2;1H

InChI key: InChIKey=CSLYBXLQBFQNMU-UHFFFAOYSA-N

SMILES: C(CN)(C1=CC=C(Cl)C=C1)N2CCCCC2.Cl

Synonyms:

• 1-Piperidineethanamine, β-(4-chlorophenyl)-, hydrochloride (1:1)

[2-(4-chlorophenyl)-2-(1-piperidinyl)ethyl]amine hydrochloride

CAS: 1609402-66-5

Formula: C₁₃H₂₀Cl₂N₂

Purity: 95.0%

Molecular weight: 275.22

Ref: 10-F359570