CAS 1609402-79-0

1-Propanamine, 3-(3-ethylphenoxy)-N-methyl-, hydrochloride (1:1)

Description:

1-Propanamine, 3-(3-ethylphenoxy)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. The presence of the 3-ethylphenoxy group indicates that it has an aromatic structure, which can influence its solubility and interaction with other molecules. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound's molecular structure suggests it may exhibit biological activity, potentially acting as a ligand or influencing neurotransmitter systems. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the overall molecular interactions and the presence of functional groups. Safety data would be essential for handling, as amines can be irritants, and proper precautions should be taken to ensure safe usage in laboratory or industrial settings.

Formula: C₁₂H₁₉NO·ClH

InChI: InChI=1S/C12H19NO.ClH/c1-3-11-6-4-7-12(10-11)14-9-5-8-13-2;/h4,6-7,10,13H,3,5,8-9H2,1-2H3;1H

InChI key: InChIKey=PESXZOKETVYNNG-UHFFFAOYSA-N

SMILES: O(CCCNC)C1=CC(CC)=CC=C1.Cl

Synonyms:

• 1-Propanamine, 3-(3-ethylphenoxy)-N-methyl-, hydrochloride (1:1)

[3-(3-ethylphenoxy)propyl]methylamine hydrochloride

CAS: 1609402-79-0

Formula: C₁₂H₂₀ClNO

Purity: 95.0%

Molecular weight: 229.75

Ref: 10-F361744