CAS 1609402-80-3

Glycine, N-methyl-N-[(4-methylphenyl)methyl]-, hydrochloride (1:1)

Description:

Glycine, N-methyl-N-[(4-methylphenyl)methyl]-, hydrochloride (1:1) is a synthetic compound that belongs to the class of amino acid derivatives. It features a glycine backbone, which is the simplest amino acid, modified by the addition of a methyl group and a 4-methylphenylmethyl group. This structure contributes to its unique properties, including its potential solubility in polar solvents due to the presence of the hydrochloride salt form. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or metabolic pathways. Its hydrochloride form enhances stability and solubility, which is advantageous for formulation in various applications. As with many amino acid derivatives, it may participate in various chemical reactions, including peptide bond formation. Safety and handling considerations should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a specific modification of glycine that could have implications in medicinal chemistry and biochemistry.

Formula: C₁₁H₁₅NO₂·ClH

InChI: InChI=1S/C11H15NO2.ClH/c1-9-3-5-10(6-4-9)7-12(2)8-11(13)14;/h3-6H,7-8H2,1-2H3,(H,13,14);1H

InChI key: InChIKey=RVWHVQVXZJOGES-UHFFFAOYSA-N

SMILES: C(N(CC(O)=O)C)C1=CC=C(C)C=C1.Cl

Synonyms:

• Glycine, N-methyl-N-[(4-methylphenyl)methyl]-, hydrochloride (1:1)

N-Methyl-N-(4-methylbenzyl)glycine hydrochloride

CAS: 1609402-80-3

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 229.7 g/mol

Ref: 3D-JPC40280