CAS 1609402-84-7

Piperidine, 3-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)

Description:

Piperidine, 3-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a triazole moiety, specifically a 3-methyl-1H-1,2,4-triazole, which contributes to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in medicinal chemistry. The presence of both the piperidine and triazole groups suggests potential interactions with biological targets, making it of interest in drug development. The compound may exhibit properties such as antimicrobial, antifungal, or antitumor activities, although specific biological effects would depend on further empirical studies. Its molecular structure and functional groups play a crucial role in determining its reactivity, stability, and overall behavior in chemical and biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly in research and industrial settings.

Formula: C₈H₁₄N₄·2ClH

InChI: InChI=1S/C8H14N4.2ClH/c1-6-10-8(12-11-6)7-3-2-4-9-5-7;;/h7,9H,2-5H2,1H3,(H,10,11,12);2*1H

InChI key: InChIKey=IPHSBXNNBLGSDL-UHFFFAOYSA-N

SMILES: CC=1NC(=NN1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(3-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:2)

3-(3-methyl-1H-1,2,4-triazol-5-yl)piperidine dihydrochloride

CAS: 1609402-84-7

Formula: C₈H₁₆Cl₂N₄

Purity: 95.0%

Molecular weight: 239.14

Ref: 10-F360699