CAS 1609402-91-6

Cyclobutanemethanamine, 1-(methoxymethyl)-, hydrochloride (1:1)

Description:

Cyclobutanemethanamine, 1-(methoxymethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and an amine functional group. The presence of the methoxymethyl substituent enhances its reactivity and solubility in various solvents. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and organic synthesis. The compound may exhibit biological activity due to the amine group, which can participate in hydrogen bonding and interact with biological targets. Its molecular properties, such as melting point, boiling point, and specific reactivity, would depend on the overall molecular structure and the presence of functional groups. Safety data and handling precautions should be considered, as with any chemical substance, particularly those involving amines and hydrochlorides, which may have specific hazards associated with them.

Formula: C₇H₁₅NO·ClH

InChI: InChI=1S/C7H15NO.ClH/c1-9-6-7(5-8)3-2-4-7;/h2-6,8H2,1H3;1H

InChI key: InChIKey=OJHZKERVGPZGJW-UHFFFAOYSA-N

SMILES: C(OC)C1(CN)CCC1.Cl

Synonyms:

• Cyclobutanemethanamine, 1-(methoxymethyl)-, hydrochloride (1:1)

{[1-(methoxymethyl)cyclobutyl]methyl}amine hydrochloride

CAS: 1609402-91-6

Formula: C₇H₁₆ClNO

Purity: 95.0%

Molecular weight: 165.66

Ref: 10-F359717