CAS 1609402-92-7

2-Quinazolineethanamine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:2)

Description:

2-Quinazolineethanamine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:2) is a chemical compound characterized by its quinazoline structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This specific derivative features a tetrahydro configuration, indicating the presence of a saturated ring system, and a methyl group at the 4-position of the quinazoline ring. The hydrochloride designation signifies that the compound is in its salt form, which enhances its solubility in water and may influence its pharmacological properties. Compounds of this nature are often studied for their potential biological activities, including effects on the central nervous system or as potential therapeutic agents. The presence of the amine functional group suggests that it may participate in hydrogen bonding, affecting its reactivity and interactions with biological targets. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and drug development.

Formula: C₁₁H₁₇N₃·2ClH

InChI: InChI=1S/C11H17N3.2ClH/c1-8-9-4-2-3-5-10(9)14-11(13-8)6-7-12;;/h2-7,12H2,1H3;2*1H

InChI key: InChIKey=DEJHGSIPORUOFU-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC(CCN)=N1)CCCC2.Cl

Synonyms:

• 2-Quinazolineethanamine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:2)

[2-(4-methyl-5,6,7,8-tetrahydro-2-quinazolinyl)ethyl]amine dihydrochloride

CAS: 1609402-92-7

Formula: C₁₁H₁₉Cl₂N₃

Purity: 95.0%

Molecular weight: 264.19

Ref: 10-F358719