CAS 1609402-93-8

Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-(3-pyridinyl)-, ethanedioate (1:1)

Description:

Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-(3-pyridinyl)-, ethanedioate (1:1), identified by CAS number 1609402-93-8, is a complex organic compound characterized by its isoquinoline core structure, which is a bicyclic aromatic compound. This specific derivative features a tetrahydroisoquinoline framework, indicating the presence of four hydrogenated carbon atoms, contributing to its saturated nature. The compound is further modified with two methoxy groups (-OCH3) at the 6 and 7 positions, enhancing its solubility and potentially influencing its biological activity. The presence of a pyridine ring at the 1-position adds to its heterocyclic nature, which can affect its reactivity and interaction with biological systems. The ethanedioate component suggests that the compound forms a salt or complex with ethanoic acid, which may influence its stability and solubility in various solvents. Overall, this compound's unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development.

Formula: C₁₆H₁₈N₂O₂·C₂H₂O₄

InChI: InChI=1S/C16H18N2O2.C2H2O4/c1-19-14-8-11-5-7-18-16(12-4-3-6-17-10-12)13(11)9-15(14)20-2;3-1(4)2(5)6/h3-4,6,8-10,16,18H,5,7H2,1-2H3;(H,3,4)(H,5,6)

InChI key: InChIKey=FABUSQFFBYHBHX-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(NCCC2=CC1OC)C=3C=CC=NC3.C(C(O)=O)(O)=O

Synonyms:

• Isoquinoline, 1,2,3,4-tetrahydro-6,7-dimethoxy-1-(3-pyridinyl)-, ethanedioate (1:1)