CAS 1609402-95-0

3-Pyrrolidineacetamide, N-methyl-, hydrochloride (1:1)

Description:

3-Pyrrolidineacetamide, N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and an acetamide functional group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in pharmaceutical and biochemical research. The presence of the N-methyl group contributes to its pharmacological properties, potentially influencing its interaction with biological targets. As a hydrochloride salt, it is generally more stable and easier to handle compared to its free base form. The compound may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which can affect its bioavailability and activity. Its specific applications may include use in drug development, particularly in the synthesis of compounds with potential therapeutic effects. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₇H₁₄N₂O·ClH

InChI: InChI=1S/C7H14N2O.ClH/c1-8-7(10)4-6-2-3-9-5-6;/h6,9H,2-5H2,1H3,(H,8,10);1H

InChI key: InChIKey=RUKNSWPRAZTOAV-UHFFFAOYSA-N

SMILES: C(C(NC)=O)C1CCNC1.Cl

Synonyms:

• 3-Pyrrolidineacetamide, N-methyl-, hydrochloride (1:1)

N-methyl-2-(3-pyrrolidinyl)acetamide hydrochloride

CAS: 1609402-95-0

Formula: C₇H₁₅ClN₂O

Purity: 95.0%

Molecular weight: 178.66

Ref: 10-F360702