CAS 1609403-24-8

2(1H)-Pyridinone, 6-(2-aminoethyl)-, hydrochloride (1:2)

Description:

2(1H)-Pyridinone, 6-(2-aminoethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridinone structure, which features a pyridine ring with a ketone functional group and an aminoethyl side chain. This compound typically exists as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in biological and medicinal chemistry. The presence of the amino group suggests potential for interactions with biological targets, possibly influencing its pharmacological properties. The molecular structure may exhibit basicity due to the amino group, allowing it to participate in protonation reactions. Additionally, the compound may display characteristics such as moderate stability under standard conditions, but it could be sensitive to moisture or extreme pH levels. Its specific applications may include roles in drug development, particularly in the synthesis of compounds with potential therapeutic effects. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₇H₁₀N₂O·2ClH

InChI: InChI=1S/C7H10N2O.2ClH/c8-5-4-6-2-1-3-7(10)9-6;;/h1-3H,4-5,8H2,(H,9,10);2*1H

InChI key: InChIKey=VOVQWWXTTAEBAA-UHFFFAOYSA-N

SMILES: C(CN)C=1NC(=O)C=CC1.Cl

Synonyms:

• 2(1H)-Pyridinone, 6-(2-aminoethyl)-, hydrochloride (1:2)

6-(2-Aminoethyl)-1,2-dihydropyridin-2-one dihydrochloride

CAS: 1609403-24-8

6-(2-Aminoethyl)-1,2-dihydropyridin-2-one dihydrochloride (CEP) is a versatile building block that is used in the research and development of complex compounds, reagents, and speciality chemicals. It is an intermediate for the production of other compounds that can be used in pharmaceuticals or agrochemicals. CEP has also been shown to be a useful scaffold for the synthesis of new compounds with potential applications as anti-cancer agents.

Formula: C₇H₁₂Cl₂N₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 211.09 g/mol

Ref: 3D-JPC40324

6-(2-aminoethyl)-2(1H)-pyridinone dihydrochloride

CAS: 1609403-24-8

Formula: C₇H₁₂Cl₂N₂O

Purity: 95.0%

Molecular weight: 211.09

Ref: 10-F360775