CAS 1609403-25-9

3-Pyrrolidinemethanamine, 1-cyclopropyl-, hydrochloride (1:2)

Description:

3-Pyrrolidinemethanamine, 1-cyclopropyl-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a cyclopropyl group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the pyrrolidine moiety suggests potential biological activity, as similar compounds are often investigated for their effects on neurotransmitter systems. The cyclopropyl group may contribute to the compound's conformational rigidity, influencing its interaction with biological targets. As a hydrochloride salt, it is generally more stable and easier to handle than its free base form. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound's structural features may render it of interest in the development of pharmaceuticals or as a research tool in the study of biological processes.

Formula: C₈H₁₆N₂·2ClH

InChI: InChI=1S/C8H16N2.2ClH/c9-5-7-3-4-10(6-7)8-1-2-8;;/h7-8H,1-6,9H2;2*1H

InChI key: InChIKey=REJXNBNPHGZOIV-UHFFFAOYSA-N

SMILES: C(N)C1CN(CC1)C2CC2.Cl

Synonyms:

• 3-Pyrrolidinemethanamine, 1-cyclopropyl-, hydrochloride (1:2)

[(1-cyclopropyl-3-pyrrolidinyl)methyl]amine dihydrochloride

CAS: 1609403-25-9

Formula: C₈H₁₈Cl₂N₂

Purity: 95.0%

Molecular weight: 213.15

Ref: 10-F360124