CAS 1609403-32-8

Ethanamine, 2-(3,5-dimethylphenoxy)-N-ethyl-, hydrochloride (1:1)

Description:

Ethanamine, 2-(3,5-dimethylphenoxy)-N-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. The presence of the 3,5-dimethylphenoxy group indicates that it has a phenolic structure, which can influence its solubility and interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in various applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having biological activity, depending on its specific structure and substituents. Its molecular interactions can be influenced by the presence of the ethyl group, which may affect its lipophilicity and ability to cross biological membranes. Overall, the characteristics of this compound suggest it could be of interest in medicinal chemistry or as a research chemical, although specific applications would depend on further studies and evaluations.

Formula: C₁₂H₁₉NO·ClH

InChI: InChI=1S/C12H19NO.ClH/c1-4-13-5-6-14-12-8-10(2)7-11(3)9-12;/h7-9,13H,4-6H2,1-3H3;1H

InChI key: InChIKey=WOKRPBKZJOGTIP-UHFFFAOYSA-N

SMILES: O(CCNCC)C1=CC(C)=CC(C)=C1.Cl

Synonyms:

• Ethanamine, 2-(3,5-dimethylphenoxy)-N-ethyl-, hydrochloride (1:1)

[2-(3,5-dimethylphenoxy)ethyl]ethylamine hydrochloride

CAS: 1609403-32-8

Formula: C₁₂H₂₀ClNO

Purity: 95.0%

Molecular weight: 229.75

Ref: 10-F361741