CAS 1609403-47-5

2-Pyridinemethanamine, N-cyclohexyl-, hydrobromide (1:2)

Description:

2-Pyridinemethanamine, N-cyclohexyl-, hydrobromide (1:2) is a chemical compound characterized by its pyridine and amine functional groups, which contribute to its basicity and potential reactivity. The presence of the cyclohexyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand in coordination chemistry or serving as an intermediate in organic synthesis. Its molecular structure suggests it could participate in hydrogen bonding, which may affect its physical properties, including melting and boiling points. Safety data should be consulted for handling, as amines can be irritants, and the hydrobromide form may have specific hazards associated with bromide compounds. Overall, this compound's unique structural features make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₂H₁₈N₂·2BrH

InChI: InChI=1S/C12H18N2.2BrH/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13-12;;/h4-5,8-9,11,14H,1-3,6-7,10H2;2*1H

InChI key: InChIKey=YFWSCIFTIIZYCZ-UHFFFAOYSA-N

SMILES: C(NC1CCCCC1)C2=CC=CC=N2.Br

Synonyms:

• 2-Pyridinemethanamine, N-cyclohexyl-, hydrobromide (1:2)

N-(2-pyridinylmethyl)cyclohexanamine dihydrobromide

CAS: 1609403-47-5

Formula: C₁₂H₂₀Br₂N₂

Purity: 95.0%

Molecular weight: 352.114

Ref: 10-F361169