CAS 1609403-49-7

1H-Pyrazole-4-methanamine, 1,3,5-trimethyl-N-(2-methylpropyl)-, hydrochloride (1:1)

Description:

1H-Pyrazole-4-methanamine, 1,3,5-trimethyl-N-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methanamine group and is substituted with trimethyl and isobutyl groups, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of multiple alkyl groups may influence its lipophilicity and biological activity. The compound is likely to exhibit basic properties due to the amine functional group, making it a potential candidate for interactions with biological targets. Safety data and handling precautions should be considered, as with any chemical substance, particularly in terms of toxicity and environmental impact. Overall, this compound's structural features suggest potential applications in medicinal chemistry and drug development, although specific biological activities would require further investigation.

Formula: C₁₁H₂₁N₃·ClH

InChI: InChI=1S/C11H21N3.ClH/c1-8(2)6-12-7-11-9(3)13-14(5)10(11)4;/h8,12H,6-7H2,1-5H3;1H

InChI key: InChIKey=CZYIOORJIMBBMG-UHFFFAOYSA-N

SMILES: C(NCC(C)C)C=1C(C)=NN(C)C1C.Cl

Synonyms:

• 1H-Pyrazole-4-methanamine, 1,3,5-trimethyl-N-(2-methylpropyl)-, hydrochloride (1:1)

2-methyl-N-[(1,3,5-trimethyl-1H-pyrazol-4-yl)methyl]-1-propanamine hydrochloride

CAS: 1609403-49-7

Formula: C₁₁H₂₂ClN₃

Purity: 95.0%

Molecular weight: 231.77

Ref: 10-F359071