CAS 1609403-56-6

3,9-Diazaspiro[5.6]dodecan-10-one, hydrochloride (1:2)

Description:

3,9-Diazaspiro[5.6]dodecan-10-one, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which incorporates two nitrogen atoms within a dodecane framework. This compound features a bicyclic arrangement that contributes to its rigidity and potential biological activity. The hydrochloride form indicates that it is a salt, which enhances its solubility in water and may influence its pharmacokinetic properties. The presence of the diaza moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may allow for various conformations, impacting its reactivity and interactions with other molecules. As a compound with a specific CAS number, it can be identified in chemical databases, facilitating research and development in fields such as drug discovery and materials science. Overall, 3,9-Diazaspiro[5.6]dodecan-10-one, hydrochloride (1:2) represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation.

Formula: C₁₀H₁₈N₂O·2ClH

InChI: InChI=1S/C10H18N2O.2ClH/c13-9-1-2-10(5-8-12-9)3-6-11-7-4-10;;/h11H,1-8H2,(H,12,13);2*1H

InChI key: InChIKey=WXFWTFHCFDDRLV-UHFFFAOYSA-N

SMILES: O=C1CCC2(CCN1)CCNCC2.Cl

Synonyms:

• 3,9-Diazaspiro[5.6]dodecan-10-one, hydrochloride (1:2)

3,9-diazaspiro[5.6]dodecan-10-one dihydrochloride

CAS: 1609403-56-6

Formula: C₁₀H₂₀Cl₂N₂O

Purity: 95.0%

Molecular weight: 255.18

Ref: 10-F360355