CAS 1609403-58-8

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, 4-methyl-, hydrochloride (1:1)

Description:

1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, 4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. The presence of the oxa and diaza groups indicates that the compound contains both an ether and two amine functionalities, contributing to its potential reactivity and solubility properties. The hydrochloride form suggests that the compound is a salt, which typically enhances its stability and solubility in polar solvents, such as water. This compound may exhibit biological activity due to its complex structure, making it of interest in medicinal chemistry and pharmacology. Its spirocyclic nature can influence its conformational flexibility and interaction with biological targets. Additionally, the presence of a methyl group may affect its lipophilicity and overall pharmacokinetic profile. As with many heterocyclic compounds, it may also participate in various chemical reactions, making it a candidate for further research in synthetic and medicinal applications.

Formula: C₉H₁₆N₂O₂·ClH

InChI: InChI=1S/C9H16N2O2.ClH/c1-11-7-9(13-6-8(11)12)2-4-10-5-3-9;/h10H,2-7H2,1H3;1H

InChI key: InChIKey=HGVHHEHOFFTUAE-UHFFFAOYSA-N

SMILES: CN1CC2(OCC1=O)CCNCC2.Cl

Synonyms:

• 1-Oxa-4,9-diazaspiro[5.5]undecan-3-one, 4-methyl-, hydrochloride (1:1)

4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one hydrochloride

CAS: 1609403-58-8

Formula: C₉H₁₇ClN₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 220.7

Ref: 10-F360778