CAS 1609403-70-4

1H-1,2,4-Triazole-3-carboxamide, 5-amino-N,N-dimethyl-, hydrate (1:1)

Description:

1H-1,2,4-Triazole-3-carboxamide, 5-amino-N,N-dimethyl-, hydrate (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a carboxamide functional group and an amino group, contributing to its potential as a bioactive molecule. The presence of the dimethyl group enhances its solubility and may influence its biological activity. As a hydrate, it contains water molecules in its crystalline structure, which can affect its stability and solubility in various solvents. This compound is of interest in pharmaceutical research, particularly for its potential applications in agriculture and medicine, including antifungal and antimicrobial properties. Its molecular interactions and reactivity can be influenced by the functional groups present, making it a subject of study in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₅H₉N₅O·H₂O

InChI: InChI=1S/C5H9N5O.H2O/c1-10(2)4(11)3-7-5(6)9-8-3;/h1-2H3,(H3,6,7,8,9);1H2

InChI key: InChIKey=XEBHDRHJOBZMKR-UHFFFAOYSA-N

SMILES: C(N(C)C)(=O)C1=NN=C(N)N1.O

Synonyms:

• 1H-1,2,4-Triazole-3-carboxamide, 5-amino-N,N-dimethyl-, hydrate (1:1)

3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide hydrate

CAS: 1609403-70-4

Formula: C₅H₁₁N₅O₂

Purity: 95.0%

Molecular weight: 173.176

Ref: 10-F360488