CAS 1609403-74-8

4-Quinazolinecarboxylic acid, 1,2-dihydro-2-oxo-, hydrate (1:1)

Description:

4-Quinazolinecarboxylic acid, 1,2-dihydro-2-oxo-, hydrate (1:1) is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This substance typically exhibits properties associated with carboxylic acids, such as the ability to form hydrogen bonds due to the presence of the carboxyl group. The dihydro-2-oxo moiety indicates that it has a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. As a hydrate, it contains water molecules in its crystalline structure, which can influence its solubility and stability. This compound may be of interest in medicinal chemistry due to its structural features, which can be modified for the development of pharmaceuticals. Its CAS number, 1609403-74-8, allows for precise identification in chemical databases and literature. Overall, this compound's unique structural characteristics make it a subject of interest in various chemical research fields.

Formula: C₉H₆N₂O₃·H₂O

InChI: InChI=1S/C9H6N2O3.H2O/c12-8(13)7-5-3-1-2-4-6(5)10-9(14)11-7;/h1-4H,(H,12,13)(H,10,11,14);1H2

InChI key: InChIKey=NIHPJHDPVITDCH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC(=O)N1)=CC=CC2.O

Synonyms:

• 4-Quinazolinecarboxylic acid, 1,2-dihydro-2-oxo-, hydrate (1:1)

2-oxo-1,2-dihydro-4-quinazolinecarboxylic acid hydrate

CAS: 1609403-74-8

Formula: C₉H₈N₂O₄

Purity: 95.0%

Molecular weight: 208.173

Ref: 10-F361015