CAS 1609403-75-9

1,2,4-Oxadiazole-3-ethanamine, N-methyl-5-(trifluoromethyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-3-ethanamine, N-methyl-5-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of the N-methyl group indicates that it has a methyl substituent on the nitrogen atom, potentially affecting its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical research. The compound's unique structure suggests potential uses in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and properties would depend on the functional groups present and their spatial arrangement, which can significantly influence its biological activity and pharmacokinetics.

Formula: C₆H₈F₃N₃O·ClH

InChI: InChI=1S/C6H8F3N3O.ClH/c1-10-3-2-4-11-5(13-12-4)6(7,8)9;/h10H,2-3H2,1H3;1H

InChI key: InChIKey=AHLIVPLLYRQBME-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=NC(CCNC)=NO1.Cl

Synonyms:

• 1,2,4-Oxadiazole-3-ethanamine, N-methyl-5-(trifluoromethyl)-, hydrochloride (1:1)

N-methyl-2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]ethanamine hydrochloride

CAS: 1609403-75-9

Formula: C₆H₉ClF₃N₃O

Purity: 95.0%

Molecular weight: 231.6

Ref: 10-F360669