CAS 1609403-82-8

Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrate (1:1)

Description:

Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrate (1:1) is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and potential for hydrogen bonding. The presence of a methyl group at the 7-position of the imidazo ring influences its steric and electronic properties, potentially affecting its reactivity and interaction with biological targets. As a hydrate, it contains water molecules in its crystalline structure, which can impact its solubility and stability. The compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its specific interactions and applications may vary based on the presence of substituents and the hydration state. Overall, this compound exemplifies the complexity and versatility of heterocyclic compounds in chemical and pharmaceutical research.

Formula: C₉H₈N₂O₂·H₂O

InChI: InChI=1S/C9H8N2O2.H2O/c1-6-2-3-11-5-7(9(12)13)10-8(11)4-6;/h2-5H,1H3,(H,12,13);1H2

InChI key: InChIKey=XCSSUOYMUWCKGK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN2C(=N1)C=C(C)C=C2.O

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrate (1:1)

7-methylimidazo[1,2-a]pyridine-2-carboxylic acid hydrate

CAS: 1609403-82-8

Formula: C₉H₁₀N₂O₃

Purity: 95.0%

Molecular weight: 194.19

Ref: 10-F361071