CAS 1609403-95-3

Imidazo[1,2-a]pyrimidine-2-methanamine, α-ethyl-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyrimidine-2-methanamine, α-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyrimidine rings. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity, making it of interest in medicinal chemistry. The presence of the α-ethyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is usually more soluble in water compared to its free base form, which is advantageous for formulation in pharmaceutical applications. The compound may exhibit various functional properties, including basicity due to the amine group, and it may participate in hydrogen bonding, influencing its interactions with biological targets. Its specific applications and effects would depend on ongoing research, particularly in the context of drug development and therapeutic uses. Safety and handling considerations should be observed, as with any chemical substance, particularly those with biological activity.

Formula: C₉H₁₂N₄·ClH

InChI: InChI=1S/C9H12N4.ClH/c1-2-7(10)8-6-13-5-3-4-11-9(13)12-8;/h3-7H,2,10H2,1H3;1H

InChI key: InChIKey=IJEOTKTXUWDOOL-UHFFFAOYSA-N

SMILES: C(CC)(N)C=1N=C2N(C1)C=CC=N2.Cl

Synonyms:

• Imidazo[1,2-a]pyrimidine-2-methanamine, α-ethyl-, hydrochloride (1:1)

(1-imidazo[1,2-a]pyrimidin-2-ylpropyl)amine hydrochloride

CAS: 1609403-95-3

Formula: C₉H₁₃ClN₄

Purity: 95.0%

Molecular weight: 212.68

Ref: 10-F360674