CAS 1609403-99-7

Spiro[piperidine-4,2′(3′H)-quinoxalin]-3′-one, 1′,4′-dihydro-, hydrochloride (1:1)

Description:

Spiro[piperidine-4,2′(3′H)-quinoxalin]-3′-one, 1′,4′-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates a piperidine ring fused to a quinoxaline moiety. This compound typically exhibits properties associated with both piperidine and quinoxaline derivatives, including potential biological activity. The presence of the hydrochloride salt form enhances its solubility in water, making it more suitable for various applications, particularly in pharmaceutical contexts. The compound may possess pharmacological properties, potentially acting as a modulator of neurotransmitter systems or exhibiting other therapeutic effects. Its molecular structure suggests the possibility of interactions with biological targets, which could be explored in drug development. As with many synthetic organic compounds, careful consideration of its stability, reactivity, and safety profile is essential for practical applications. Further research would be necessary to fully elucidate its characteristics and potential uses in medicinal chemistry or related fields.

Formula: C₁₂H₁₅N₃O·ClH

InChI: InChI=1S/C12H15N3O.ClH/c16-11-12(5-7-13-8-6-12)15-10-4-2-1-3-9(10)14-11;/h1-4,13,15H,5-8H2,(H,14,16);1H

InChI key: InChIKey=PLDVZHBLJHFBNQ-UHFFFAOYSA-N

SMILES: O=C1C2(NC=3C(N1)=CC=CC3)CCNCC2.Cl

Synonyms:

• Spiro[piperidine-4,2′(3′H)-quinoxalin]-3′-one, 1′,4′-dihydro-, hydrochloride (1:1)

1',4'-dihydro-3'H-spiro[piperidine-4,2'-quinoxalin]-3'-one hydrochloride

CAS: 1609403-99-7

Purity: 95.0%

Molecular weight: 253.72999572753906

Ref: 10-F402050