CAS 1609404-08-1

1H-1,2,4-Triazole-1-ethanamine, β-methyl-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole-1-ethanamine, β-methyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which is indicative of its hydrochloride salt form. The presence of the β-methyl group contributes to its unique properties, potentially influencing its biological activity and solubility. As a triazole derivative, it may exhibit antifungal, antibacterial, or other pharmacological activities, making it of interest in medicinal chemistry. The hydrochloride form enhances its stability and solubility, facilitating its use in various applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound represents a significant class of triazole derivatives with potential utility in various scientific fields.

Formula: C₅H₁₀N₄.ClH

InChI: InChI=1S/C5H10N4.ClH/c1-5(2-6)9-4-7-3-8-9;/h3-5H,2,6H2,1H3;1H

InChI key: InChIKey=VDULIFWVCHLVES-UHFFFAOYSA-N

SMILES: C(CN)(C)N1C=NC=N1.Cl

[2-(1H-1,2,4-triazol-1-yl)propyl]amine hydrochloride

CAS: 1609404-08-1

Formula: C₅H₁₁ClN₄

Purity: 95.0%

Molecular weight: 162.62

Ref: 10-F359327