CAS 1609404-13-8

Benzenemethanamine, 5-bromo-N-cyclopentyl-2-methoxy-, hydrobromide (1:1)

Description:

Benzenemethanamine, 5-bromo-N-cyclopentyl-2-methoxy-, hydrobromide (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring, a methanamine group, and a cyclopentyl substituent. The presence of a bromine atom at the 5-position of the benzene ring contributes to its reactivity and potential applications in organic synthesis. The methoxy group enhances its solubility and may influence its biological activity. As a hydrobromide salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical formulations. The compound's unique combination of functional groups suggests potential uses in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and properties would depend on the molecular conformation and the presence of other substituents, which can affect its pharmacokinetics and pharmacodynamics. Overall, this compound represents a valuable entity for further research in both synthetic and medicinal chemistry.

Formula: C₁₃H₁₈BrNO·BrH

InChI: InChI=1S/C13H18BrNO.BrH/c1-16-13-7-6-11(14)8-10(13)9-15-12-4-2-3-5-12;/h6-8,12,15H,2-5,9H2,1H3;1H

InChI key: InChIKey=CCQVZFCWSNHWCV-UHFFFAOYSA-N

SMILES: C(NC1CCCC1)C2=C(OC)C=CC(Br)=C2.Br

Synonyms:

• Benzenemethanamine, 5-bromo-N-cyclopentyl-2-methoxy-, hydrobromide (1:1)

N-(5-bromo-2-methoxybenzyl)cyclopentanamine hydrobromide

CAS: 1609404-13-8

Formula: C₁₃H₁₉Br₂NO

Purity: 95.0%

Molecular weight: 365.109

Ref: 10-F361248