CAS 1609404-14-9

1,2,4-Oxadiazole-5-methanamine, 3-(2-methylpropyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-methanamine, 3-(2-methylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methanamine group attached to the oxadiazole, contributing to its potential biological activity. The presence of the 2-methylpropyl substituent enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in drug design and synthesis. Overall, this compound exemplifies the diverse chemistry of heterocycles and their derivatives in the context of medicinal chemistry.

Formula: C₇H₁₃N₃O·ClH

InChI: InChI=1S/C7H13N3O.ClH/c1-5(2)3-6-9-7(4-8)11-10-6;/h5H,3-4,8H2,1-2H3;1H

InChI key: InChIKey=RSBDZKIWIMEJAL-UHFFFAOYSA-N

SMILES: C(C(C)C)C=1N=C(CN)ON1.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-methanamine, 3-(2-methylpropyl)-, hydrochloride (1:1)

[(3-isobutyl-1,2,4-oxadiazol-5-yl)methyl]amine hydrochloride

CAS: 1609404-14-9

Formula: C₇H₁₄ClN₃O

Purity: 95.0%

Molecular weight: 191.66

Ref: 10-F358676