CAS 1609406-28-1

1,2,4-Oxadiazole, 3-(1-methylethyl)-5-(2-pyrrolidinyl)-, 2,2,2-trifluoroacetate (1:1)

Description:

1,2,4-Oxadiazole, 3-(1-methylethyl)-5-(2-pyrrolidinyl)-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its oxadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and three carbon atoms. This specific derivative features a branched alkyl group (isopropyl) and a pyrrolidine moiety, contributing to its potential biological activity. The presence of the trifluoroacetate group enhances its solubility and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound's unique structure may impart specific reactivity and interaction properties, which can be explored in medicinal chemistry for developing new therapeutic agents. Additionally, the trifluoromethyl group is known for its influence on lipophilicity and metabolic stability, which are critical factors in drug design. Overall, this compound exemplifies the diverse functionalities that can be achieved through strategic molecular design in heterocyclic chemistry.

Formula: C₉H₁₅N₃O·C₂HF₃O₂

InChI: InChI=1S/C9H15N3O.C2HF3O2/c1-6(2)8-11-9(13-12-8)7-4-3-5-10-7;3-2(4,5)1(6)7/h6-7,10H,3-5H2,1-2H3;(H,6,7)

InChI key: InChIKey=CBRUVALCERAESE-UHFFFAOYSA-N

SMILES: C(C)(C)C=1N=C(ON1)C2CCCN2.C(C(O)=O)(F)(F)F

Synonyms:

• 1,2,4-Oxadiazole, 3-(1-methylethyl)-5-(2-pyrrolidinyl)-, 2,2,2-trifluoroacetate (1:1)

3-isopropyl-5-(2-pyrrolidinyl)-1,2,4-oxadiazole trifluoroacetate

CAS: 1609406-28-1

Formula: C₁₁H₁₆F₃N₃O₃

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 295.262

Ref: 10-F359193