CAS 1609406-54-3

1H-Benzimidazol-6-amine, 1-methyl-, hydrochloride (1:2)

Description:

1H-Benzimidazol-6-amine, 1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methyl group attached to the nitrogen of the benzimidazole, enhancing its solubility and biological activity. The hydrochloride form indicates that it is a salt, which typically improves stability and solubility in aqueous solutions. This substance may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. The compound's CAS number, 1609406-54-3, provides a unique identifier for its chemical identity, facilitating research and regulatory processes. As with many amines, it may participate in acid-base reactions and can be involved in the formation of various derivatives, expanding its utility in chemical synthesis and drug development.

Formula: C₈H₉N₃·2ClH

InChI: InChI=1S/C8H9N3.2ClH/c1-11-5-10-7-3-2-6(9)4-8(7)11;;/h2-5H,9H2,1H3;2*1H

InChI key: InChIKey=RHSUOSLARRPQMU-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC=C(N)C2)N=C1.Cl

Synonyms:

• 1H-Benzimidazol-6-amine, 1-methyl-, hydrochloride (1:2)

1-methyl-1H-benzimidazol-6-amine dihydrochloride

CAS: 1609406-54-3

Formula: C₈H₁₁Cl₂N₃

Purity: 95.0%

Molecular weight: 220.1

Ref: 10-F361388

1-Methyl-1H-1,3-benzodiazol-6-amine dihydrochloride

CAS: 1609406-54-3

Versatile small molecule scaffold

Formula: C₈H₁₁Cl₂N₃

Purity: Min. 95%

Molecular weight: 220.1 g/mol

Ref: 3D-JPC40654